C22H18FN3O3 — CID 175362046
3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-[(4-fluorophenyl)methyl]-5-nitroindol-2-one (PubChem CID 175362046) has the molecular formula C22H18FN3O3 and a molecular weight of 391.40 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-[(4-fluorophenyl)methyl]-5-nitroindol-2-one.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-[(4-fluorophenyl)methyl]-5-nitroindol-2-one |
|---|---|
| PubChem CID | 175362046 |
| Molecular Formula | C22H18FN3O3 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1-[(4-fluorophenyl)methyl]-5-nitroindol-2-one |
| SMILES | Cc1cc(C)c(C=C2C(=O)N(Cc3ccc(F)cc3)c3ccc([N+](=O)[O-])cc32)[nH]1 |
| InChI | InChI=1S/C22H18FN3O3/c1-13-9-14(2)24-20(13)11-19-18-10-17(26(28)29)7-8-21(18)25(22(19)27)12-15-3-5-16(23)6-4-15/h3-11,24H,12H2,1-2H3 |
| InChIKey | WCQXMCBVURCTLG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|