About disodium;butanedioate;dihexyl butanedioate
disodium;butanedioate;dihexyl butanedioate (PubChem CID 175362616) has the molecular formula C20H34Na2O8
and a molecular weight of 448.46 g/mol. Its IUPAC name is disodium;butanedioate;dihexyl butanedioate.
Molecular Properties
| Compound Name | disodium;butanedioate;dihexyl butanedioate |
| PubChem CID | 175362616 |
| Molecular Formula | C20H34Na2O8 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | disodium;butanedioate;dihexyl butanedioate |
| SMILES | CCCCCCOC(=O)CCC(=O)OCCCCCC.O=C([O-])CCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C16H30O4.C4H6O4.2Na/c1-3-5-7-9-13-19-15(17)11-12-16(18)20-14-10-8-6-4-2;5-3(6)1-2-4(7)8;;/h3-14H2,1-2H3;1-2H2,(H,5,6)(H,7,8);;/q;;2*+1/p-2 |
| InChIKey | BKZKAMVJZXBCMR-UHFFFAOYSA-L |
| XLogP | -4.71 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;butanedioate;dihexyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;butanedioate;dihexyl butanedioate?
The IUPAC name of disodium;butanedioate;dihexyl butanedioate (CID 175362616) is disodium;butanedioate;dihexyl butanedioate.
What is the SMILES notation for disodium;butanedioate;dihexyl butanedioate?
The canonical SMILES for disodium;butanedioate;dihexyl butanedioate is CCCCCCOC(=O)CCC(=O)OCCCCCC.O=C([O-])CCC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;butanedioate;dihexyl butanedioate?
The InChIKey is BKZKAMVJZXBCMR-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H30O4.C4H6O4.2Na/c1-3-5-7-9-13-19-15(17)11-12-16(18)20-14-10-8-6-4-2;5-3(6)1-2-4(7)8;;/h3-14H2,1-2H3;1-2H2,(H,5,6)(H,7,8);;/q;;2*+1/p-2.
What are the key properties of disodium;butanedioate;dihexyl butanedioate?
disodium;butanedioate;dihexyl butanedioate has a molecular weight of 448.46 g/mol, XLogP of -4.71, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;butanedioate;dihexyl butanedioate is sourced from PubChem (CID 175362616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).