C20H23N3O5S — CID 175362968
(2R)-1-[4-[4-(2-aminopropanoylamino)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 175362968) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is (2R)-1-[4-[4-(2-aminopropanoylamino)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-[4-(2-aminopropanoylamino)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175362968 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (2R)-1-[4-[4-(2-aminopropanoylamino)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | CC(N)C(=O)Nc1ccc(-c2ccc(S(=O)(=O)N3CCC[C@@H]3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-13(21)19(24)22-16-8-4-14(5-9-16)15-6-10-17(11-7-15)29(27,28)23-12-2-3-18(23)20(25)26/h4-11,13,18H,2-3,12,21H2,1H3,(H,22,24)(H,25,26)/t13?,18-/m1/s1 |
| InChIKey | IZZTYUFAVRFQLD-PQJIZZRHSA-N |
| XLogP | 1.88 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |