C21H33FN4 — CID 175363192
azane;N-[(6-fluoroquinolin-4-yl)-piperidin-4-ylmethyl]-3-methylpentan-3-amine (PubChem CID 175363192) has the molecular formula C21H33FN4 and a molecular weight of 360.52 g/mol. Its IUPAC name is azane;N-[(6-fluoroquinolin-4-yl)-piperidin-4-ylmethyl]-3-methylpentan-3-amine.
| Compound Name | azane;N-[(6-fluoroquinolin-4-yl)-piperidin-4-ylmethyl]-3-methylpentan-3-amine |
|---|---|
| PubChem CID | 175363192 |
| Molecular Formula | C21H33FN4 |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | azane;N-[(6-fluoroquinolin-4-yl)-piperidin-4-ylmethyl]-3-methylpentan-3-amine |
| SMILES | CCC(C)(CC)NC(c1ccnc2ccc(F)cc12)C1CCNCC1.N |
| InChI | InChI=1S/C21H30FN3.H3N/c1-4-21(3,5-2)25-20(15-8-11-23-12-9-15)17-10-13-24-19-7-6-16(22)14-18(17)19;/h6-7,10,13-15,20,23,25H,4-5,8-9,11-12H2,1-3H3;1H3 |
| InChIKey | CFEPITQCIUSFLQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |