C19H24BrN3O — CID 175363676
N-amino-4-bromo-N'-[(2S,3S)-2-phenylmethoxypentan-3-yl]benzenecarboximidamide (PubChem CID 175363676) has the molecular formula C19H24BrN3O and a molecular weight of 390.33 g/mol. Its IUPAC name is N-amino-4-bromo-N'-[(2S,3S)-2-phenylmethoxypentan-3-yl]benzenecarboximidamide.
| Compound Name | N-amino-4-bromo-N'-[(2S,3S)-2-phenylmethoxypentan-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 175363676 |
| Molecular Formula | C19H24BrN3O |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-amino-4-bromo-N'-[(2S,3S)-2-phenylmethoxypentan-3-yl]benzenecarboximidamide |
| SMILES | CC[C@H](/N=C(\NN)c1ccc(Br)cc1)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C19H24BrN3O/c1-3-18(14(2)24-13-15-7-5-4-6-8-15)22-19(23-21)16-9-11-17(20)12-10-16/h4-12,14,18H,3,13,21H2,1-2H3,(H,22,23)/t14-,18-/m0/s1 |
| InChIKey | SMLYOKZWCOHBNQ-KSSFIOAISA-N |
| XLogP | 4.04 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|