C11H13NO2S — CID 175363789
3-(4-methyl-2-sulfanylphenyl)morpholin-2-one (PubChem CID 175363789) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(4-methyl-2-sulfanylphenyl)morpholin-2-one.
| Compound Name | 3-(4-methyl-2-sulfanylphenyl)morpholin-2-one |
|---|---|
| PubChem CID | 175363789 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(4-methyl-2-sulfanylphenyl)morpholin-2-one |
| SMILES | Cc1ccc(C2NCCOC2=O)c(S)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-7-2-3-8(9(15)6-7)10-11(13)14-5-4-12-10/h2-3,6,10,12,15H,4-5H2,1H3 |
| InChIKey | MUQHRRUINSTZFY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|