C25H48N4O2 — CID 175368764
octyl (3R,4R,5S)-5-(diaminomethylideneamino)-3-(2-ethylbutyl)-4-(propan-2-ylamino)cyclohexene-1-carboxylate (PubChem CID 175368764) has the molecular formula C25H48N4O2 and a molecular weight of 436.69 g/mol. Its IUPAC name is octyl (3R,4R,5S)-5-(diaminomethylideneamino)-3-(2-ethylbutyl)-4-(propan-2-ylamino)cyclohexene-1-carboxylate.
| Compound Name | octyl (3R,4R,5S)-5-(diaminomethylideneamino)-3-(2-ethylbutyl)-4-(propan-2-ylamino)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 175368764 |
| Molecular Formula | C25H48N4O2 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | octyl (3R,4R,5S)-5-(diaminomethylideneamino)-3-(2-ethylbutyl)-4-(propan-2-ylamino)cyclohexene-1-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C[C@@H](CC(CC)CC)[C@@H](NC(C)C)[C@@H](N=C(N)N)C1 |
| InChI | InChI=1S/C25H48N4O2/c1-6-9-10-11-12-13-14-31-24(30)21-16-20(15-19(7-2)8-3)23(28-18(4)5)22(17-21)29-25(26)27/h16,18-20,22-23,28H,6-15,17H2,1-5H3,(H4,26,27,29)/t20-,22+,23-/m1/s1 |
| InChIKey | IRXODZSICRMFLD-AKIFATBCSA-N |
| XLogP | 4.67 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|