C11H20N4O2 — CID 59954547
methyl (3R)-5-(diaminomethylideneamino)-3-methyl-4-(methylamino)cyclohexene-1-carboxylate (PubChem CID 59954547) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is methyl (3R)-5-(diaminomethylideneamino)-3-methyl-4-(methylamino)cyclohexene-1-carboxylate.
| Compound Name | methyl (3R)-5-(diaminomethylideneamino)-3-methyl-4-(methylamino)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 59954547 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | methyl (3R)-5-(diaminomethylideneamino)-3-methyl-4-(methylamino)cyclohexene-1-carboxylate |
| SMILES | CNC1C(N=C(N)N)CC(C(=O)OC)=C[C@H]1C |
| InChI | InChI=1S/C11H20N4O2/c1-6-4-7(10(16)17-3)5-8(9(6)14-2)15-11(12)13/h4,6,8-9,14H,5H2,1-3H3,(H4,12,13,15)/t6-,8?,9?/m1/s1 |
| InChIKey | KPOBBQSBPJNLSF-KXNKJCORSA-N |
| XLogP | -0.64 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|