C20H16O4 — CID 175370166
4-(9H-fluoren-9-yloxycarbonyl)-2-methylpenta-2,4-dienoic acid (PubChem CID 175370166) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-(9H-fluoren-9-yloxycarbonyl)-2-methylpenta-2,4-dienoic acid.
| Compound Name | 4-(9H-fluoren-9-yloxycarbonyl)-2-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 175370166 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-(9H-fluoren-9-yloxycarbonyl)-2-methylpenta-2,4-dienoic acid |
| SMILES | C=C(C=C(C)C(=O)O)C(=O)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H16O4/c1-12(19(21)22)11-13(2)20(23)24-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-11,18H,2H2,1H3,(H,21,22) |
| InChIKey | KWYJCGHKGQPFJZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|