C17H15NO3 — CID 175370851
1-methyl-7-phenoxy-3,4-dihydroisoquinoline-3-carboxylic acid (PubChem CID 175370851) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-methyl-7-phenoxy-3,4-dihydroisoquinoline-3-carboxylic acid.
| Compound Name | 1-methyl-7-phenoxy-3,4-dihydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 175370851 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-methyl-7-phenoxy-3,4-dihydroisoquinoline-3-carboxylic acid |
| SMILES | CC1=NC(C(=O)O)Cc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C17H15NO3/c1-11-15-10-14(21-13-5-3-2-4-6-13)8-7-12(15)9-16(18-11)17(19)20/h2-8,10,16H,9H2,1H3,(H,19,20) |
| InChIKey | OVWLVEPHFYSARA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |