C12H11Br2NO4 — CID 175371153
4-bromo-3-methylbenzoic acid;1-bromopyrrolidine-2,5-dione (PubChem CID 175371153) has the molecular formula C12H11Br2NO4 and a molecular weight of 393.03 g/mol. Its IUPAC name is 4-bromo-3-methylbenzoic acid;1-bromopyrrolidine-2,5-dione.
| Compound Name | 4-bromo-3-methylbenzoic acid;1-bromopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175371153 |
| Molecular Formula | C12H11Br2NO4 |
| Molecular Weight | 393.03 g/mol |
| Exact Mass | 390.91 |
| IUPAC Name | 4-bromo-3-methylbenzoic acid;1-bromopyrrolidine-2,5-dione |
| SMILES | Cc1cc(C(=O)O)ccc1Br.O=C1CCC(=O)N1Br |
| InChI | InChI=1S/C8H7BrO2.C4H4BrNO2/c1-5-4-6(8(10)11)2-3-7(5)9;5-6-3(7)1-2-4(6)8/h2-4H,1H3,(H,10,11);1-2H2 |
| InChIKey | ZFAVXZBKUBFNRC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.03 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|