C23H23NO7 — CID 175373662
(7S)-1,2,3-trimethoxy-10-oxo-7-(prop-2-enoylamino)-6,7-dihydro-5H-benzo[a]heptalene-9-carboxylic acid (PubChem CID 175373662) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is (7S)-1,2,3-trimethoxy-10-oxo-7-(prop-2-enoylamino)-6,7-dihydro-5H-benzo[a]heptalene-9-carboxylic acid.
| Compound Name | (7S)-1,2,3-trimethoxy-10-oxo-7-(prop-2-enoylamino)-6,7-dihydro-5H-benzo[a]heptalene-9-carboxylic acid |
|---|---|
| PubChem CID | 175373662 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (7S)-1,2,3-trimethoxy-10-oxo-7-(prop-2-enoylamino)-6,7-dihydro-5H-benzo[a]heptalene-9-carboxylic acid |
| SMILES | C=CC(=O)N[C@H]1CCc2cc(OC)c(OC)c(OC)c2-c2ccc(=O)c(C(=O)O)cc21 |
| InChI | InChI=1S/C23H23NO7/c1-5-19(26)24-16-8-6-12-10-18(29-2)21(30-3)22(31-4)20(12)13-7-9-17(25)15(23(27)28)11-14(13)16/h5,7,9-11,16H,1,6,8H2,2-4H3,(H,24,26)(H,27,28)/t16-/m0/s1 |
| InChIKey | PHJSHVQDGXDTHS-INIZCTEOSA-N |
| XLogP | 2.73 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|