C14H17F3N2OS — CID 175376180
tert-butyl-[1-[3-cyano-5-(trifluoromethyl)phenyl]ethylamino]-oxidosulfanium (PubChem CID 175376180) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is tert-butyl-[1-[3-cyano-5-(trifluoromethyl)phenyl]ethylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[3-cyano-5-(trifluoromethyl)phenyl]ethylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175376180 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | tert-butyl-[1-[3-cyano-5-(trifluoromethyl)phenyl]ethylamino]-oxidosulfanium |
| SMILES | CC(N[S+]([O-])C(C)(C)C)c1cc(C#N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2OS/c1-9(19-21(20)13(2,3)4)11-5-10(8-18)6-12(7-11)14(15,16)17/h5-7,9,19H,1-4H3 |
| InChIKey | DWPCWMBYPATXCV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|