About N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride
N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride (PubChem CID 175377849) has the molecular formula C14H18Cl2N2O
and a molecular weight of 301.22 g/mol. Its IUPAC name is N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride.
Molecular Properties
| Compound Name | N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride |
| PubChem CID | 175377849 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride |
| SMILES | CC(C)NNC(=O)c1cc2cccccc-2c1.Cl.Cl |
| InChI | InChI=1S/C14H16N2O.2ClH/c1-10(2)15-16-14(17)13-8-11-6-4-3-5-7-12(11)9-13;;/h3-10,15H,1-2H3,(H,16,17);2*1H |
| InChIKey | RGKZZWIFTVOSTB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride?
The IUPAC name of N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride (CID 175377849) is N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride.
What is the SMILES notation for N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride?
The canonical SMILES for N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride is CC(C)NNC(=O)c1cc2cccccc-2c1.Cl.Cl.
What is the InChIKey of N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride?
The InChIKey is RGKZZWIFTVOSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O.2ClH/c1-10(2)15-16-14(17)13-8-11-6-4-3-5-7-12(11)9-13;;/h3-10,15H,1-2H3,(H,16,17);2*1H.
What are the key properties of N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride?
N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride has a molecular weight of 301.22 g/mol, XLogP of 3.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-propan-2-ylazulene-2-carbohydrazide;dihydrochloride is sourced from PubChem (CID 175377849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).