C9H13N3O — CID 162641981
2,3,5,6-tetradeuterio-N'-propan-2-ylpyridine-4-carbohydrazide (PubChem CID 162641981) has the molecular formula C9H13N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N'-propan-2-ylpyridine-4-carbohydrazide.
| Compound Name | 2,3,5,6-tetradeuterio-N'-propan-2-ylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 162641981 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N'-propan-2-ylpyridine-4-carbohydrazide |
| SMILES | [2H]c1nc([2H])c([2H])c(C(=O)NNC(C)C)c1[2H] |
| InChI | InChI=1S/C9H13N3O/c1-7(2)11-12-9(13)8-3-5-10-6-4-8/h3-7,11H,1-2H3,(H,12,13)/i3D,4D,5D,6D |
| InChIKey | NYMGNSNKLVNMIA-LNFUJOGGSA-N |
| XLogP | 0.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|