C19H24N4O4S3 — CID 158983100
methyl thiophene-3-carboxylate;N'-propan-2-ylthiophene-3-carbohydrazide;thiophene-3-carbohydrazide (PubChem CID 158983100) has the molecular formula C19H24N4O4S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is methyl thiophene-3-carboxylate;N'-propan-2-ylthiophene-3-carbohydrazide;thiophene-3-carbohydrazide.
| Compound Name | methyl thiophene-3-carboxylate;N'-propan-2-ylthiophene-3-carbohydrazide;thiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 158983100 |
| Molecular Formula | C19H24N4O4S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | methyl thiophene-3-carboxylate;N'-propan-2-ylthiophene-3-carbohydrazide;thiophene-3-carbohydrazide |
| SMILES | CC(C)NNC(=O)c1ccsc1.COC(=O)c1ccsc1.NNC(=O)c1ccsc1 |
| InChI | InChI=1S/C8H12N2OS.C6H6O2S.C5H6N2OS/c1-6(2)9-10-8(11)7-3-4-12-5-7;1-8-6(7)5-2-3-9-4-5;6-7-5(8)4-1-2-9-3-4/h3-6,9H,1-2H3,(H,10,11);2-4H,1H3;1-3H,6H2,(H,7,8) |
| InChIKey | JPFZFIHTTPXIGS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|