C8H10N2O3S — CID 140739614
N'-(2-hydroxypropanoyl)thiophene-3-carbohydrazide (PubChem CID 140739614) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is N'-(2-hydroxypropanoyl)thiophene-3-carbohydrazide.
| Compound Name | N'-(2-hydroxypropanoyl)thiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 140739614 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | N'-(2-hydroxypropanoyl)thiophene-3-carbohydrazide |
| SMILES | CC(O)C(=O)NNC(=O)c1ccsc1 |
| InChI | InChI=1S/C8H10N2O3S/c1-5(11)7(12)9-10-8(13)6-2-3-14-4-6/h2-5,11H,1H3,(H,9,12)(H,10,13) |
| InChIKey | BBGZWVDJBVHVBS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|