C14H15N3O5S2 — CID 140662590
N-[[4-(2-hydroxypropanoylamino)-2-methyl-3-pyridinyl]sulfonyl]thiophene-3-carboxamide (PubChem CID 140662590) has the molecular formula C14H15N3O5S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[[4-(2-hydroxypropanoylamino)-2-methyl-3-pyridinyl]sulfonyl]thiophene-3-carboxamide.
| Compound Name | N-[[4-(2-hydroxypropanoylamino)-2-methyl-3-pyridinyl]sulfonyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 140662590 |
| Molecular Formula | C14H15N3O5S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[[4-(2-hydroxypropanoylamino)-2-methyl-3-pyridinyl]sulfonyl]thiophene-3-carboxamide |
| SMILES | Cc1nccc(NC(=O)C(C)O)c1S(=O)(=O)NC(=O)c1ccsc1 |
| InChI | InChI=1S/C14H15N3O5S2/c1-8-12(11(3-5-15-8)16-13(19)9(2)18)24(21,22)17-14(20)10-4-6-23-7-10/h3-7,9,18H,1-2H3,(H,17,20)(H,15,16,19) |
| InChIKey | DIYFDBXJYPBXDJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |