C9H12N2O3S — CID 140662618
N'-(2-hydroxy-2-methylpropanoyl)thiophene-3-carbohydrazide (PubChem CID 140662618) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is N'-(2-hydroxy-2-methylpropanoyl)thiophene-3-carbohydrazide.
| Compound Name | N'-(2-hydroxy-2-methylpropanoyl)thiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 140662618 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N'-(2-hydroxy-2-methylpropanoyl)thiophene-3-carbohydrazide |
| SMILES | CC(C)(O)C(=O)NNC(=O)c1ccsc1 |
| InChI | InChI=1S/C9H12N2O3S/c1-9(2,14)8(13)11-10-7(12)6-3-4-15-5-6/h3-5,14H,1-2H3,(H,10,12)(H,11,13) |
| InChIKey | DEDORHOFGIVXHU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|