C23H21FN2O6S2 — CID 175381269
1-(4-fluorophenyl)sulfonyl-7-(4-methoxycarbonyl-N-sulfinoanilino)-3,4-dihydro-2H-quinoline (PubChem CID 175381269) has the molecular formula C23H21FN2O6S2 and a molecular weight of 504.56 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-7-(4-methoxycarbonyl-N-sulfinoanilino)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-7-(4-methoxycarbonyl-N-sulfinoanilino)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 175381269 |
| Molecular Formula | C23H21FN2O6S2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-7-(4-methoxycarbonyl-N-sulfinoanilino)-3,4-dihydro-2H-quinoline |
| SMILES | COC(=O)c1ccc(N(c2ccc3c(c2)N(S(=O)(=O)c2ccc(F)cc2)CCC3)S(=O)O)cc1 |
| InChI | InChI=1S/C23H21FN2O6S2/c1-32-23(27)17-5-9-19(10-6-17)26(33(28)29)20-11-4-16-3-2-14-25(22(16)15-20)34(30,31)21-12-7-18(24)8-13-21/h4-13,15H,2-3,14H2,1H3,(H,28,29) |
| InChIKey | UCHKCRZJBGANSM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|