C13H9N3O — CID 175381328
7-phenyl-3H-1,2,3-benzotriazin-4-one (PubChem CID 175381328) has the molecular formula C13H9N3O and a molecular weight of 223.24 g/mol. Its IUPAC name is 7-phenyl-3H-1,2,3-benzotriazin-4-one.
| Compound Name | 7-phenyl-3H-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 175381328 |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 7-phenyl-3H-1,2,3-benzotriazin-4-one |
| SMILES | O=c1[nH]nnc2cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C13H9N3O/c17-13-11-7-6-10(8-12(11)14-16-15-13)9-4-2-1-3-5-9/h1-8H,(H,14,15,17) |
| InChIKey | FZFJMPZXZWRHGY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |