C24H42N2OS — CID 175383456
1-(2-methoxy-5,8,9,10-tetramethylundecyl)-3-(4-methylphenyl)thiourea (PubChem CID 175383456) has the molecular formula C24H42N2OS and a molecular weight of 406.68 g/mol. Its IUPAC name is 1-(2-methoxy-5,8,9,10-tetramethylundecyl)-3-(4-methylphenyl)thiourea.
| Compound Name | 1-(2-methoxy-5,8,9,10-tetramethylundecyl)-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 175383456 |
| Molecular Formula | C24H42N2OS |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | 1-(2-methoxy-5,8,9,10-tetramethylundecyl)-3-(4-methylphenyl)thiourea |
| SMILES | COC(CCC(C)CCC(C)C(C)C(C)C)CNC(=S)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H42N2OS/c1-17(2)21(6)20(5)12-8-18(3)11-15-23(27-7)16-25-24(28)26-22-13-9-19(4)10-14-22/h9-10,13-14,17-18,20-21,23H,8,11-12,15-16H2,1-7H3,(H2,25,26,28) |
| InChIKey | AOYCMYNMPGYGAO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|