C19H17IN6O2 — CID 175385379
[1-(4-cyano-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-4-phenylpiperidin-4-yl] carbamate (PubChem CID 175385379) has the molecular formula C19H17IN6O2 and a molecular weight of 488.29 g/mol. Its IUPAC name is [1-(4-cyano-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-4-phenylpiperidin-4-yl] carbamate.
| Compound Name | [1-(4-cyano-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-4-phenylpiperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175385379 |
| Molecular Formula | C19H17IN6O2 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | [1-(4-cyano-5-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-4-phenylpiperidin-4-yl] carbamate |
| SMILES | N#Cc1nc(N2CCC(OC(N)=O)(c3ccccc3)CC2)nc2[nH]cc(I)c12 |
| InChI | InChI=1S/C19H17IN6O2/c20-13-11-23-16-15(13)14(10-21)24-18(25-16)26-8-6-19(7-9-26,28-17(22)27)12-4-2-1-3-5-12/h1-5,11H,6-9H2,(H2,22,27)(H,23,24,25) |
| InChIKey | OARCUCGFLKKPCO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|