C19H27BrO2 — CID 175385508
4-bromo-1-(4-nonylphenyl)butane-1,3-dione (PubChem CID 175385508) has the molecular formula C19H27BrO2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-bromo-1-(4-nonylphenyl)butane-1,3-dione.
| Compound Name | 4-bromo-1-(4-nonylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 175385508 |
| Molecular Formula | C19H27BrO2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-bromo-1-(4-nonylphenyl)butane-1,3-dione |
| SMILES | CCCCCCCCCc1ccc(C(=O)CC(=O)CBr)cc1 |
| InChI | InChI=1S/C19H27BrO2/c1-2-3-4-5-6-7-8-9-16-10-12-17(13-11-16)19(22)14-18(21)15-20/h10-13H,2-9,14-15H2,1H3 |
| InChIKey | PVOORECLUUTUQY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|