C14H18Ti — CID 175385628
bis(2,3-dimethylcyclopenta-1,3-diene);titanium(2+) (PubChem CID 175385628) has the molecular formula C14H18Ti and a molecular weight of 234.16 g/mol. Its IUPAC name is bis(2,3-dimethylcyclopenta-1,3-diene);titanium(2+).
| Compound Name | bis(2,3-dimethylcyclopenta-1,3-diene);titanium(2+) |
|---|---|
| PubChem CID | 175385628 |
| Molecular Formula | C14H18Ti |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | bis(2,3-dimethylcyclopenta-1,3-diene);titanium(2+) |
| SMILES | CC1=[C-]CC=C1C.CC1=[C-]CC=C1C.[Ti+2] |
| InChI | InChI=1S/2C7H9.Ti/c2*1-6-4-3-5-7(6)2;/h2*4H,3H2,1-2H3;/q2*-1;+2 |
| InChIKey | HFEDDDIRABWBEY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|