C12H14Mg — CID 174383038
magnesium;cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,3-diene (PubChem CID 174383038) has the molecular formula C12H14Mg and a molecular weight of 182.55 g/mol. Its IUPAC name is magnesium;cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,3-diene.
| Compound Name | magnesium;cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174383038 |
| Molecular Formula | C12H14Mg |
| Molecular Weight | 182.55 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | magnesium;cyclopenta-1,3-diene;2,3-dimethylcyclopenta-1,3-diene |
| SMILES | CC1=[C-]CC=C1C.[C-]1=CC=CC1.[Mg+2] |
| InChI | InChI=1S/C7H9.C5H5.Mg/c1-6-4-3-5-7(6)2;1-2-4-5-3-1;/h4H,3H2,1-2H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | YIXHOIDAQOAWCZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|