C12H7F10I — CID 175387011
1-fluoro-4-(2,2,3,3,4,4,5,6,6-nonafluoro-1-iodohexyl)benzene (PubChem CID 175387011) has the molecular formula C12H7F10I and a molecular weight of 468.07 g/mol. Its IUPAC name is 1-fluoro-4-(2,2,3,3,4,4,5,6,6-nonafluoro-1-iodohexyl)benzene.
| Compound Name | 1-fluoro-4-(2,2,3,3,4,4,5,6,6-nonafluoro-1-iodohexyl)benzene |
|---|---|
| PubChem CID | 175387011 |
| Molecular Formula | C12H7F10I |
| Molecular Weight | 468.07 g/mol |
| Exact Mass | 467.94 |
| IUPAC Name | 1-fluoro-4-(2,2,3,3,4,4,5,6,6-nonafluoro-1-iodohexyl)benzene |
| SMILES | Fc1ccc(C(I)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H7F10I/c13-6-3-1-5(2-4-6)8(23)11(19,20)12(21,22)10(17,18)7(14)9(15)16/h1-4,7-9H |
| InChIKey | HUYIYIOYLDEZRB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.07 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|