About 2-pyrrolidin-2-ylbenzoyl chloride
2-pyrrolidin-2-ylbenzoyl chloride (PubChem CID 175389600) has the molecular formula C11H12ClNO
and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-pyrrolidin-2-ylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-ylbenzoyl chloride |
| PubChem CID | 175389600 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-pyrrolidin-2-ylbenzoyl chloride |
| SMILES | O=C(Cl)c1ccccc1C1CCCN1 |
| InChI | InChI=1S/C11H12ClNO/c12-11(14)9-5-2-1-4-8(9)10-6-3-7-13-10/h1-2,4-5,10,13H,3,6-7H2 |
| InChIKey | VNINROOLHZYETR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-2-ylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-ylbenzoyl chloride?
The IUPAC name of 2-pyrrolidin-2-ylbenzoyl chloride (CID 175389600) is 2-pyrrolidin-2-ylbenzoyl chloride.
What is the SMILES notation for 2-pyrrolidin-2-ylbenzoyl chloride?
The canonical SMILES for 2-pyrrolidin-2-ylbenzoyl chloride is O=C(Cl)c1ccccc1C1CCCN1.
What is the InChIKey of 2-pyrrolidin-2-ylbenzoyl chloride?
The InChIKey is VNINROOLHZYETR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c12-11(14)9-5-2-1-4-8(9)10-6-3-7-13-10/h1-2,4-5,10,13H,3,6-7H2.
What are the key properties of 2-pyrrolidin-2-ylbenzoyl chloride?
2-pyrrolidin-2-ylbenzoyl chloride has a molecular weight of 209.68 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-ylbenzoyl chloride is sourced from PubChem (CID 175389600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).