C17H31NO4 — CID 175392197
methyl (2S)-2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoate (PubChem CID 175392197) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is methyl (2S)-2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoate.
| Compound Name | methyl (2S)-2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 175392197 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | methyl (2S)-2-(3-cyclohexylpropoxycarbonylamino)-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)OCCCC1CCCCC1 |
| InChI | InChI=1S/C17H31NO4/c1-13(2)12-15(16(19)21-3)18-17(20)22-11-7-10-14-8-5-4-6-9-14/h13-15H,4-12H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | RBRFGTLKDRSTJK-HNNXBMFYSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|