About lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane
lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane (PubChem CID 175392491) has the molecular formula C3H9LiO4P+
and a molecular weight of 147.02 g/mol. Its IUPAC name is lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane.
Molecular Properties
| Compound Name | lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane |
| PubChem CID | 175392491 |
| Molecular Formula | C3H9LiO4P+ |
| Molecular Weight | 147.02 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane |
| SMILES | O=[P+](O)O.[CH2-]OCC.[Li+] |
| InChI | InChI=1S/C3H7O.Li.HO3P/c1-3-4-2;;1-4(2)3/h2-3H2,1H3;;(H-,1,2,3)/q-1;+1;/p+1 |
| InChIKey | BWAKXCCAJRUDLA-UHFFFAOYSA-O |
| XLogP | -2.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.02 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane?
The IUPAC name of lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane (CID 175392491) is lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane.
What is the SMILES notation for lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane?
The canonical SMILES for lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane is O=[P+](O)O.[CH2-]OCC.[Li+].
What is the InChIKey of lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane?
The InChIKey is BWAKXCCAJRUDLA-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7O.Li.HO3P/c1-3-4-2;;1-4(2)3/h2-3H2,1H3;;(H-,1,2,3)/q-1;+1;/p+1.
What are the key properties of lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane?
lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane has a molecular weight of 147.02 g/mol, XLogP of -2.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;dihydroxy(oxo)phosphanium;methanidyloxyethane is sourced from PubChem (CID 175392491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).