About 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride
3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride (PubChem CID 175392727) has the molecular formula C9H17ClN2O2
and a molecular weight of 220.70 g/mol. Its IUPAC name is 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride.
Molecular Properties
| Compound Name | 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride |
| PubChem CID | 175392727 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride |
| SMILES | Cl.O=CC1OCCN1C1CCNCC1 |
| InChI | InChI=1S/C9H16N2O2.ClH/c12-7-9-11(5-6-13-9)8-1-3-10-4-2-8;/h7-10H,1-6H2;1H |
| InChIKey | AUWTZAAKEMKCGC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride?
The IUPAC name of 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride (CID 175392727) is 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride.
What is the SMILES notation for 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride?
The canonical SMILES for 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride is Cl.O=CC1OCCN1C1CCNCC1.
What is the InChIKey of 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride?
The InChIKey is AUWTZAAKEMKCGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2.ClH/c12-7-9-11(5-6-13-9)8-1-3-10-4-2-8;/h7-10H,1-6H2;1H.
What are the key properties of 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride?
3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride has a molecular weight of 220.70 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-yl-1,3-oxazolidine-2-carbaldehyde;hydrochloride is sourced from PubChem (CID 175392727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).