C30H37N3O2 — CID 175393058
N-[[4-[(2-nonylanilino)carbamoyl]phenyl]methyl]benzamide (PubChem CID 175393058) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[[4-[(2-nonylanilino)carbamoyl]phenyl]methyl]benzamide.
| Compound Name | N-[[4-[(2-nonylanilino)carbamoyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 175393058 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | N-[[4-[(2-nonylanilino)carbamoyl]phenyl]methyl]benzamide |
| SMILES | CCCCCCCCCc1ccccc1NNC(=O)c1ccc(CNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H37N3O2/c1-2-3-4-5-6-7-9-14-25-15-12-13-18-28(25)32-33-30(35)27-21-19-24(20-22-27)23-31-29(34)26-16-10-8-11-17-26/h8,10-13,15-22,32H,2-7,9,14,23H2,1H3,(H,31,34)(H,33,35) |
| InChIKey | RZDFRYSOTYNSLG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|