C17H26O2S — CID 175393813
1-(thionin-2-yl)nonane-1,4-diol (PubChem CID 175393813) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is 1-(thionin-2-yl)nonane-1,4-diol.
| Compound Name | 1-(thionin-2-yl)nonane-1,4-diol |
|---|---|
| PubChem CID | 175393813 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-(thionin-2-yl)nonane-1,4-diol |
| SMILES | CCCCCC(O)CCC(O)c1cccccccs1 |
| InChI | InChI=1S/C17H26O2S/c1-2-3-7-10-15(18)12-13-16(19)17-11-8-5-4-6-9-14-20-17/h4-6,8-9,11,14-16,18-19H,2-3,7,10,12-13H2,1H3/b6-4-,8-5-,14-9-,17-11- |
| InChIKey | UZTXAKPVJCXOKS-UBLJAXRFSA-N |
| XLogP | 4.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|