C21H22FN5O4 — CID 175394497
N-[[3-[4-[4-[(carbamoylhydrazinylidene)methyl]-3-methylphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 175394497) has the molecular formula C21H22FN5O4 and a molecular weight of 427.44 g/mol. Its IUPAC name is N-[[3-[4-[4-[(carbamoylhydrazinylidene)methyl]-3-methylphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-[(carbamoylhydrazinylidene)methyl]-3-methylphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 175394497 |
| Molecular Formula | C21H22FN5O4 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[[3-[4-[4-[(carbamoylhydrazinylidene)methyl]-3-methylphenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(-c3ccc(C=NNC(N)=O)c(C)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H22FN5O4/c1-12-7-14(3-4-15(12)9-25-26-20(23)29)18-6-5-16(8-19(18)22)27-11-17(31-21(27)30)10-24-13(2)28/h3-9,17H,10-11H2,1-2H3,(H,24,28)(H3,23,26,29) |
| InChIKey | WKGKCLQMIQAMOK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|