C34H27N2O3P — CID 175394870
ethyl 5-diphenylphosphoryl-4-(2-phenylnaphthalen-1-yl)-1H-pyrazole-3-carboxylate (PubChem CID 175394870) has the molecular formula C34H27N2O3P and a molecular weight of 542.58 g/mol. Its IUPAC name is ethyl 5-diphenylphosphoryl-4-(2-phenylnaphthalen-1-yl)-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-diphenylphosphoryl-4-(2-phenylnaphthalen-1-yl)-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 175394870 |
| Molecular Formula | C34H27N2O3P |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | ethyl 5-diphenylphosphoryl-4-(2-phenylnaphthalen-1-yl)-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c(P(=O)(c2ccccc2)c2ccccc2)c1-c1c(-c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C34H27N2O3P/c1-2-39-34(37)32-31(30-28-21-13-12-16-25(28)22-23-29(30)24-14-6-3-7-15-24)33(36-35-32)40(38,26-17-8-4-9-18-26)27-19-10-5-11-20-27/h3-23H,2H2,1H3,(H,35,36) |
| InChIKey | TXYBSRQSKCBCOU-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|