C18H24BrF2N3O3 — CID 175396172
tert-butyl N-[[1-(2-bromo-5-methylpyridine-4-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]carbamate (PubChem CID 175396172) has the molecular formula C18H24BrF2N3O3 and a molecular weight of 448.31 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-bromo-5-methylpyridine-4-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-bromo-5-methylpyridine-4-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 175396172 |
| Molecular Formula | C18H24BrF2N3O3 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | tert-butyl N-[[1-(2-bromo-5-methylpyridine-4-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]carbamate |
| SMILES | Cc1cnc(Br)cc1C(=O)N1CC(F)(F)CCC1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24BrF2N3O3/c1-11-8-22-14(19)7-13(11)15(25)24-10-18(20,21)6-5-12(24)9-23-16(26)27-17(2,3)4/h7-8,12H,5-6,9-10H2,1-4H3,(H,23,26) |
| InChIKey | RIGAAKDIQLYFRV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|