C12H17F2N3O — CID 175397411
5-(4,4-difluorocyclohexyl)-1,4-dimethylimidazole-2-carboxamide (PubChem CID 175397411) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 5-(4,4-difluorocyclohexyl)-1,4-dimethylimidazole-2-carboxamide.
| Compound Name | 5-(4,4-difluorocyclohexyl)-1,4-dimethylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 175397411 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 5-(4,4-difluorocyclohexyl)-1,4-dimethylimidazole-2-carboxamide |
| SMILES | Cc1nc(C(N)=O)n(C)c1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H17F2N3O/c1-7-9(17(2)11(16-7)10(15)18)8-3-5-12(13,14)6-4-8/h8H,3-6H2,1-2H3,(H2,15,18) |
| InChIKey | BOTDIKPCBLGUCX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |