C15H26N2 — CID 169322180
2-tert-butyl-4-cyclohexyl-1,5-dimethylimidazole (PubChem CID 169322180) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-tert-butyl-4-cyclohexyl-1,5-dimethylimidazole.
| Compound Name | 2-tert-butyl-4-cyclohexyl-1,5-dimethylimidazole |
|---|---|
| PubChem CID | 169322180 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-tert-butyl-4-cyclohexyl-1,5-dimethylimidazole |
| SMILES | Cc1c(C2CCCCC2)nc(C(C)(C)C)n1C |
| InChI | InChI=1S/C15H26N2/c1-11-13(12-9-7-6-8-10-12)16-14(17(11)5)15(2,3)4/h12H,6-10H2,1-5H3 |
| InChIKey | NGKXMIWTOIFVLE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |