C19H35NO2 — CID 175398948
3-methyl-2-[[1-(3-methylcyclohexyl)cycloheptyl]amino]butanoic acid (PubChem CID 175398948) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is 3-methyl-2-[[1-(3-methylcyclohexyl)cycloheptyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[1-(3-methylcyclohexyl)cycloheptyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175398948 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 3-methyl-2-[[1-(3-methylcyclohexyl)cycloheptyl]amino]butanoic acid |
| SMILES | CC1CCCC(C2(NC(C(=O)O)C(C)C)CCCCCC2)C1 |
| InChI | InChI=1S/C19H35NO2/c1-14(2)17(18(21)22)20-19(11-6-4-5-7-12-19)16-10-8-9-15(3)13-16/h14-17,20H,4-13H2,1-3H3,(H,21,22) |
| InChIKey | NVJSTCLVKYJFHS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |