C20H20F2O4 — CID 175399751
2-[4-(2-cyclobutyloxy-3-fluorophenyl)-2-fluorophenoxy]butanoic acid (PubChem CID 175399751) has the molecular formula C20H20F2O4 and a molecular weight of 362.37 g/mol. Its IUPAC name is 2-[4-(2-cyclobutyloxy-3-fluorophenyl)-2-fluorophenoxy]butanoic acid.
| Compound Name | 2-[4-(2-cyclobutyloxy-3-fluorophenyl)-2-fluorophenoxy]butanoic acid |
|---|---|
| PubChem CID | 175399751 |
| Molecular Formula | C20H20F2O4 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[4-(2-cyclobutyloxy-3-fluorophenyl)-2-fluorophenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(-c2cccc(F)c2OC2CCC2)cc1F)C(=O)O |
| InChI | InChI=1S/C20H20F2O4/c1-2-17(20(23)24)26-18-10-9-12(11-16(18)22)14-7-4-8-15(21)19(14)25-13-5-3-6-13/h4,7-11,13,17H,2-3,5-6H2,1H3,(H,23,24) |
| InChIKey | SBLKZGALQQGRKA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |