C28H55N3O7 — CID 175400230
2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-[[(Z)-octadec-9-enoyl]amino]acetic acid (PubChem CID 175400230) has the molecular formula C28H55N3O7 and a molecular weight of 545.76 g/mol. Its IUPAC name is 2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-[[(Z)-octadec-9-enoyl]amino]acetic acid.
| Compound Name | 2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-[[(Z)-octadec-9-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 175400230 |
| Molecular Formula | C28H55N3O7 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.40 |
| IUPAC Name | 2-aminoacetic acid;2-amino-4-methylpentanoic acid;2-[[(Z)-octadec-9-enoyl]amino]acetic acid |
| SMILES | CC(C)CC(N)C(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)NCC(=O)O.NCC(=O)O |
| InChI | InChI=1S/C20H37NO3.C6H13NO2.C2H5NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24;1-4(2)3-5(7)6(8)9;3-1-2(4)5/h9-10H,2-8,11-18H2,1H3,(H,21,22)(H,23,24);4-5H,3,7H2,1-2H3,(H,8,9);1,3H2,(H,4,5)/b10-9-;; |
| InChIKey | JPAVUJHIIUYOSS-XXAVUKJNSA-N |
| XLogP | 4.70 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|