About ethyl octanoate;1H-imidazole
ethyl octanoate;1H-imidazole (PubChem CID 175401289) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is ethyl octanoate;1H-imidazole.
Molecular Properties
| Compound Name | ethyl octanoate;1H-imidazole |
| PubChem CID | 175401289 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | ethyl octanoate;1H-imidazole |
| SMILES | CCCCCCCC(=O)OCC.c1c[nH]cn1 |
| InChI | InChI=1S/C10H20O2.C3H4N2/c1-3-5-6-7-8-9-10(11)12-4-2;1-2-5-3-4-1/h3-9H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | YQGLBCSCSMFOMS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl octanoate;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl octanoate;1H-imidazole?
The IUPAC name of ethyl octanoate;1H-imidazole (CID 175401289) is ethyl octanoate;1H-imidazole.
What is the SMILES notation for ethyl octanoate;1H-imidazole?
The canonical SMILES for ethyl octanoate;1H-imidazole is CCCCCCCC(=O)OCC.c1c[nH]cn1.
What is the InChIKey of ethyl octanoate;1H-imidazole?
The InChIKey is YQGLBCSCSMFOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C3H4N2/c1-3-5-6-7-8-9-10(11)12-4-2;1-2-5-3-4-1/h3-9H2,1-2H3;1-3H,(H,4,5).
What are the key properties of ethyl octanoate;1H-imidazole?
ethyl octanoate;1H-imidazole has a molecular weight of 240.35 g/mol, XLogP of 3.32, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl octanoate;1H-imidazole is sourced from PubChem (CID 175401289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).