C4H4Cl2O3 — CID 175402057
(E)-2,3-dichloro-4-hydroxybut-2-enoic acid (PubChem CID 175402057) has the molecular formula C4H4Cl2O3 and a molecular weight of 170.98 g/mol. Its IUPAC name is (E)-2,3-dichloro-4-hydroxybut-2-enoic acid.
| Compound Name | (E)-2,3-dichloro-4-hydroxybut-2-enoic acid |
|---|---|
| PubChem CID | 175402057 |
| Molecular Formula | C4H4Cl2O3 |
| Molecular Weight | 170.98 g/mol |
| Exact Mass | 169.95 |
| IUPAC Name | (E)-2,3-dichloro-4-hydroxybut-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(\Cl)CO |
| InChI | InChI=1S/C4H4Cl2O3/c5-2(1-7)3(6)4(8)9/h7H,1H2,(H,8,9)/b3-2+ |
| InChIKey | SFJRNQRMOVSEOI-NSCUHMNNSA-N |
| XLogP | 0.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.98 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|