About (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid
(Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid (PubChem CID 92530778) has the molecular formula C5H7Cl2N3O3
and a molecular weight of 228.03 g/mol. Its IUPAC name is (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid |
| PubChem CID | 92530778 |
| Molecular Formula | C5H7Cl2N3O3 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid |
| SMILES | NC(=O)NNC/C(Cl)=C(/Cl)C(=O)O |
| InChI | InChI=1S/C5H7Cl2N3O3/c6-2(3(7)4(11)12)1-9-10-5(8)13/h9H,1H2,(H,11,12)(H3,8,10,13)/b3-2- |
| InChIKey | MVHCEQZFPSRLLL-IHWYPQMZSA-N |
| XLogP | -0.07 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid?
The IUPAC name of (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid (CID 92530778) is (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid.
What is the SMILES notation for (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid?
The canonical SMILES for (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid is NC(=O)NNC/C(Cl)=C(/Cl)C(=O)O.
What is the InChIKey of (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid?
The InChIKey is MVHCEQZFPSRLLL-IHWYPQMZSA-N. The full InChI is InChI=1S/C5H7Cl2N3O3/c6-2(3(7)4(11)12)1-9-10-5(8)13/h9H,1H2,(H,11,12)(H3,8,10,13)/b3-2-.
What are the key properties of (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid?
(Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid has a molecular weight of 228.03 g/mol, XLogP of -0.07, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(2-carbamoylhydrazinyl)-2,3-dichlorobut-2-enoic acid is sourced from PubChem (CID 92530778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).