C9H16ClN3O — CID 98513307
[[(1R,2R,4R,7S)-7-chloro-2-bicyclo[2.2.1]heptanyl]methylamino]urea (PubChem CID 98513307) has the molecular formula C9H16ClN3O and a molecular weight of 217.70 g/mol. Its IUPAC name is [[(1R,2R,4R,7S)-7-chloro-2-bicyclo[2.2.1]heptanyl]methylamino]urea.
| Compound Name | [[(1R,2R,4R,7S)-7-chloro-2-bicyclo[2.2.1]heptanyl]methylamino]urea |
|---|---|
| PubChem CID | 98513307 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | [[(1R,2R,4R,7S)-7-chloro-2-bicyclo[2.2.1]heptanyl]methylamino]urea |
| SMILES | NC(=O)NNC[C@@H]1C[C@H]2CC[C@H]1[C@H]2Cl |
| InChI | InChI=1S/C9H16ClN3O/c10-8-5-1-2-7(8)6(3-5)4-12-13-9(11)14/h5-8,12H,1-4H2,(H3,11,13,14)/t5-,6+,7-,8+/m1/s1 |
| InChIKey | ZLVOXPYJWNUPBK-CWKFCGSDSA-N |
| XLogP | 0.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|