C10H15ClO2 — CID 130865140
1-[(1S,2S,4S,5R,6R)-6-chloro-5-hydroxy-2-bicyclo[2.2.1]heptanyl]propan-2-one (PubChem CID 130865140) has the molecular formula C10H15ClO2 and a molecular weight of 202.68 g/mol. Its IUPAC name is 1-[(1S,2S,4S,5R,6R)-6-chloro-5-hydroxy-2-bicyclo[2.2.1]heptanyl]propan-2-one.
| Compound Name | 1-[(1S,2S,4S,5R,6R)-6-chloro-5-hydroxy-2-bicyclo[2.2.1]heptanyl]propan-2-one |
|---|---|
| PubChem CID | 130865140 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-[(1S,2S,4S,5R,6R)-6-chloro-5-hydroxy-2-bicyclo[2.2.1]heptanyl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1C[C@H]2C[C@@H]1[C@@H](Cl)[C@@H]2O |
| InChI | InChI=1S/C10H15ClO2/c1-5(12)2-6-3-7-4-8(6)9(11)10(7)13/h6-10,13H,2-4H2,1H3/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | SFRCOUBVTNGWKK-SOYHJAILSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|