C17H14ClF3O6 — CID 175405006
[2-(chloromethyl)phenyl] hydrogen carbonate;[2-(2,2,2-trifluoroethyl)phenyl] hydrogen carbonate (PubChem CID 175405006) has the molecular formula C17H14ClF3O6 and a molecular weight of 406.74 g/mol. Its IUPAC name is [2-(chloromethyl)phenyl] hydrogen carbonate;[2-(2,2,2-trifluoroethyl)phenyl] hydrogen carbonate.
| Compound Name | [2-(chloromethyl)phenyl] hydrogen carbonate;[2-(2,2,2-trifluoroethyl)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 175405006 |
| Molecular Formula | C17H14ClF3O6 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [2-(chloromethyl)phenyl] hydrogen carbonate;[2-(2,2,2-trifluoroethyl)phenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccccc1CC(F)(F)F.O=C(O)Oc1ccccc1CCl |
| InChI | InChI=1S/C9H7F3O3.C8H7ClO3/c10-9(11,12)5-6-3-1-2-4-7(6)15-8(13)14;9-5-6-3-1-2-4-7(6)12-8(10)11/h1-4H,5H2,(H,13,14);1-4H,5H2,(H,10,11) |
| InChIKey | FLYNELAAUYFPBV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|