C16H11Cl2FN2O — CID 175405978
6,7-dichloro-5-(2-fluorophenyl)-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde (PubChem CID 175405978) has the molecular formula C16H11Cl2FN2O and a molecular weight of 337.18 g/mol. Its IUPAC name is 6,7-dichloro-5-(2-fluorophenyl)-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde.
| Compound Name | 6,7-dichloro-5-(2-fluorophenyl)-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde |
|---|---|
| PubChem CID | 175405978 |
| Molecular Formula | C16H11Cl2FN2O |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 6,7-dichloro-5-(2-fluorophenyl)-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde |
| SMILES | O=CC1CN=C(c2ccccc2F)c2c(ccc(Cl)c2Cl)N1 |
| InChI | InChI=1S/C16H11Cl2FN2O/c17-11-5-6-13-14(15(11)18)16(20-7-9(8-22)21-13)10-3-1-2-4-12(10)19/h1-6,8-9,21H,7H2 |
| InChIKey | HUKGAJCLKHVRCJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|