C16H12ClIN2O — CID 174272501
5-(2-chlorophenyl)-7-iodo-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde (PubChem CID 174272501) has the molecular formula C16H12ClIN2O and a molecular weight of 410.64 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-iodo-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde.
| Compound Name | 5-(2-chlorophenyl)-7-iodo-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde |
|---|---|
| PubChem CID | 174272501 |
| Molecular Formula | C16H12ClIN2O |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 5-(2-chlorophenyl)-7-iodo-2,3-dihydro-1H-1,4-benzodiazepine-2-carbaldehyde |
| SMILES | O=CC1CN=C(c2ccccc2Cl)c2cc(I)ccc2N1 |
| InChI | InChI=1S/C16H12ClIN2O/c17-14-4-2-1-3-12(14)16-13-7-10(18)5-6-15(13)20-11(9-21)8-19-16/h1-7,9,11,20H,8H2 |
| InChIKey | WRUNOEKIQCWTMC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|