C10H20O5S — CID 175406090
sulfane;4,4,5-trimethoxy-2-methylhex-2-enoic acid (PubChem CID 175406090) has the molecular formula C10H20O5S and a molecular weight of 252.33 g/mol. Its IUPAC name is sulfane;4,4,5-trimethoxy-2-methylhex-2-enoic acid.
| Compound Name | sulfane;4,4,5-trimethoxy-2-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 175406090 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | sulfane;4,4,5-trimethoxy-2-methylhex-2-enoic acid |
| SMILES | COC(C)C(C=C(C)C(=O)O)(OC)OC.S |
| InChI | InChI=1S/C10H18O5.H2S/c1-7(9(11)12)6-10(14-4,15-5)8(2)13-3;/h6,8H,1-5H3,(H,11,12);1H2 |
| InChIKey | MNUYERUOQHOYFV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|